C27H28F3N7O — CID 138538064
1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-[[1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]amino]pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138538064) has the molecular formula C27H28F3N7O and a molecular weight of 523.56 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-[[1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]amino]pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-[[1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]amino]pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138538064 |
| Molecular Formula | C27H28F3N7O |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-[[1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]amino]pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)CCNC4C(F)(F)F)nc2n1-c1ccnc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H28F3N7O/c1-5-12-36-24(38)20-15-33-25(35-23(20)37(36)18-9-11-31-21(14-18)26(2,3)4)34-17-6-7-19-16(13-17)8-10-32-22(19)27(28,29)30/h5-7,9,11,13-15,22,32H,1,8,10,12H2,2-4H3,(H,33,34,35) |
| InChIKey | PJBXAVFRLLWANH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|