C23H23FN6O — CID 142557143
4-(4-fluoroanilino)-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide (PubChem CID 142557143) has the molecular formula C23H23FN6O and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-(4-fluoroanilino)-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide.
| Compound Name | 4-(4-fluoroanilino)-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142557143 |
| Molecular Formula | C23H23FN6O |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-(4-fluoroanilino)-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc3c(c2)CCNC3)nc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN6O/c1-2-10-26-22(31)20-14-27-23(30-21(20)28-18-7-4-17(24)5-8-18)29-19-6-3-16-13-25-11-9-15(16)12-19/h2-8,12,14,25H,1,9-11,13H2,(H,26,31)(H2,27,28,29,30) |
| InChIKey | ZHVLDKGGDXXFBC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|