C23H26F3N7OS — CID 155709552
4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide (PubChem CID 155709552) has the molecular formula C23H26F3N7OS and a molecular weight of 505.57 g/mol. Its IUPAC name is 4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide.
| Compound Name | 4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155709552 |
| Molecular Formula | C23H26F3N7OS |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-N-(2,2,2-trifluoroethyl)pyrimidine-5-carboxamide |
| SMILES | CC(C)(C)c1csc(Nc2nc(Nc3ccc4c(c3)CCNC4)ncc2C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C23H26F3N7OS/c1-22(2,3)17-11-35-21(31-17)33-18-16(19(34)29-12-23(24,25)26)10-28-20(32-18)30-15-5-4-14-9-27-7-6-13(14)8-15/h4-5,8,10-11,27H,6-7,9,12H2,1-3H3,(H,29,34)(H2,28,30,31,32,33) |
| InChIKey | LCPVFFDVSMHVLQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |