C26H35N7O2 — CID 142557244
4-[[(1E,3Z)-1-amino-6-hydroxy-5,6-dimethylhepta-1,3-dienyl]amino]-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide (PubChem CID 142557244) has the molecular formula C26H35N7O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-[[(1E,3Z)-1-amino-6-hydroxy-5,6-dimethylhepta-1,3-dienyl]amino]-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide.
| Compound Name | 4-[[(1E,3Z)-1-amino-6-hydroxy-5,6-dimethylhepta-1,3-dienyl]amino]-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142557244 |
| Molecular Formula | C26H35N7O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 4-[[(1E,3Z)-1-amino-6-hydroxy-5,6-dimethylhepta-1,3-dienyl]amino]-N-prop-2-enyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc3c(c2)CCNC3)nc1N/C(N)=C/C=C\C(C)C(C)(C)O |
| InChI | InChI=1S/C26H35N7O2/c1-5-12-29-24(34)21-16-30-25(31-20-10-9-19-15-28-13-11-18(19)14-20)33-23(21)32-22(27)8-6-7-17(2)26(3,4)35/h5-10,14,16-17,28,35H,1,11-13,15,27H2,2-4H3,(H,29,34)(H2,30,31,32,33)/b7-6-,22-8+ |
| InChIKey | ZNWPSFFSGPBONJ-PKRQGZDISA-N |
| XLogP | 2.96 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|