C22H30N6 — CID 44526804
7-cyclobutyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 44526804) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 7-cyclobutyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-cyclobutyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 44526804 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 7-cyclobutyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cc(Nc2ncc3c(n2)N(C2CCC2)CC3)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C22H30N6/c1-16-14-18(6-7-20(16)27-12-10-26(2)11-13-27)24-22-23-15-17-8-9-28(21(17)25-22)19-4-3-5-19/h6-7,14-15,19H,3-5,8-13H2,1-2H3,(H,23,24,25) |
| InChIKey | RMOQYDGYDXSLEM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|