C19H22N6O3S — CID 143570984
6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylanilino]-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 143570984) has the molecular formula C19H22N6O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylanilino]-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylanilino]-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 143570984 |
| Molecular Formula | C19H22N6O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylanilino]-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1[nH]c2nc(Nc3ccc(N4CCS(=O)(=O)CC4)c(C)c3)ncc2c1=O |
| InChI | InChI=1S/C19H22N6O3S/c1-3-6-25-18(26)15-12-20-19(22-17(15)23-25)21-14-4-5-16(13(2)11-14)24-7-9-29(27,28)10-8-24/h3-5,11-12H,1,6-10H2,2H3,(H2,20,21,22,23) |
| InChIKey | YNFUSTZUXIKYRP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|