C22H28N8O2 — CID 143571046
N,N-dimethyl-2-[4-[4-[(3-oxo-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]piperazin-1-yl]acetamide (PubChem CID 143571046) has the molecular formula C22H28N8O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[4-[(3-oxo-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]piperazin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-[4-[(3-oxo-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 143571046 |
| Molecular Formula | C22H28N8O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N,N-dimethyl-2-[4-[4-[(3-oxo-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]piperazin-1-yl]acetamide |
| SMILES | C=CCn1[nH]c2nc(Nc3ccc(N4CCN(CC(=O)N(C)C)CC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C22H28N8O2/c1-4-9-30-21(32)18-14-23-22(25-20(18)26-30)24-16-5-7-17(8-6-16)29-12-10-28(11-13-29)15-19(31)27(2)3/h4-8,14H,1,9-13,15H2,2-3H3,(H2,23,24,25,26) |
| InChIKey | XAROJTYUIWRORZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|