C28H31N7O — CID 89388423
8-phenyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-6-prop-2-enylpyrimido[4,5-d]pyridazin-5-one (PubChem CID 89388423) has the molecular formula C28H31N7O and a molecular weight of 481.60 g/mol. Its IUPAC name is 8-phenyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-6-prop-2-enylpyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 8-phenyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-6-prop-2-enylpyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 89388423 |
| Molecular Formula | C28H31N7O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 8-phenyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-6-prop-2-enylpyrimido[4,5-d]pyridazin-5-one |
| SMILES | C=CCn1nc(-c2ccccc2)c2nc(Nc3ccc(N4CCN(C(C)C)CC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C28H31N7O/c1-4-14-35-27(36)24-19-29-28(31-26(24)25(32-35)21-8-6-5-7-9-21)30-22-10-12-23(13-11-22)34-17-15-33(16-18-34)20(2)3/h4-13,19-20H,1,14-18H2,2-3H3,(H,29,30,31) |
| InChIKey | IDFVEJGTHNQZBV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|