C28H30N8O — CID 71224573
3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxo-8-(2-phenylethyl)pyrimido[4,5-d]pyridazin-6-yl]propanenitrile (PubChem CID 71224573) has the molecular formula C28H30N8O and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxo-8-(2-phenylethyl)pyrimido[4,5-d]pyridazin-6-yl]propanenitrile.
| Compound Name | 3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxo-8-(2-phenylethyl)pyrimido[4,5-d]pyridazin-6-yl]propanenitrile |
|---|---|
| PubChem CID | 71224573 |
| Molecular Formula | C28H30N8O |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxo-8-(2-phenylethyl)pyrimido[4,5-d]pyridazin-6-yl]propanenitrile |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n(CCC#N)nc(CCc5ccccc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C28H30N8O/c1-34-16-18-35(19-17-34)23-11-9-22(10-12-23)31-28-30-20-24-26(32-28)25(13-8-21-6-3-2-4-7-21)33-36(27(24)37)15-5-14-29/h2-4,6-7,9-12,20H,5,8,13,15-19H2,1H3,(H,30,31,32) |
| InChIKey | VYACOONAFPUEJU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|