C27H29N7O2 — CID 71724768
6-benzyl-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[4,3-d]pyrimidine-8-carboxamide (PubChem CID 71724768) has the molecular formula C27H29N7O2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 6-benzyl-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[4,3-d]pyrimidine-8-carboxamide.
| Compound Name | 6-benzyl-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[4,3-d]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 71724768 |
| Molecular Formula | C27H29N7O2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 6-benzyl-N-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[4,3-d]pyrimidine-8-carboxamide |
| SMILES | CNC(=O)c1cn(Cc2ccccc2)c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc12 |
| InChI | InChI=1S/C27H29N7O2/c1-28-25(35)23-18-34(17-19-6-4-3-5-7-19)26(36)22-16-29-27(31-24(22)23)30-20-8-10-21(11-9-20)33-14-12-32(2)13-15-33/h3-11,16,18H,12-15,17H2,1-2H3,(H,28,35)(H,29,30,31) |
| InChIKey | MUASXNRDGTUSIE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|