C20H21N5O3 — CID 151440366
6-acetyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrano[2,3-d]pyrimidin-7-one (PubChem CID 151440366) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-acetyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrano[2,3-d]pyrimidin-7-one.
| Compound Name | 6-acetyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrano[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 151440366 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 6-acetyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrano[2,3-d]pyrimidin-7-one |
| SMILES | CC(=O)c1cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2oc1=O |
| InChI | InChI=1S/C20H21N5O3/c1-13(26)17-11-14-12-21-20(23-18(14)28-19(17)27)22-15-3-5-16(6-4-15)25-9-7-24(2)8-10-25/h3-6,11-12H,7-10H2,1-2H3,(H,21,22,23) |
| InChIKey | PEJQNXWKOHRNAY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|