C26H35N7O — CID 174180811
6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-(1,5-oxazonan-5-yl)pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 174180811) has the molecular formula C26H35N7O and a molecular weight of 461.61 g/mol. Its IUPAC name is 6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-(1,5-oxazonan-5-yl)pyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | 6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-(1,5-oxazonan-5-yl)pyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 174180811 |
| Molecular Formula | C26H35N7O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-(1,5-oxazonan-5-yl)pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | Cc1cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2c(N2CCCCOCCC2)n1 |
| InChI | InChI=1S/C26H35N7O/c1-20-18-21-19-27-26(29-22-6-8-23(9-7-22)32-14-12-31(2)13-15-32)30-24(21)25(28-20)33-10-3-4-16-34-17-5-11-33/h6-9,18-19H,3-5,10-17H2,1-2H3,(H,27,29,30) |
| InChIKey | QMWOOHJYMQCPDN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|