C21H28N6 — CID 70951109
7-cyclopropyl-5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 70951109) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is 7-cyclopropyl-5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-cyclopropyl-5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 70951109 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 7-cyclopropyl-5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC1CN(C2CC2)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc21 |
| InChI | InChI=1S/C21H28N6/c1-15-14-27(18-7-8-18)20-19(15)13-22-21(24-20)23-16-3-5-17(6-4-16)26-11-9-25(2)10-12-26/h3-6,13,15,18H,7-12,14H2,1-2H3,(H,22,23,24) |
| InChIKey | BCMQVXMPQZDAGJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|