C24H27ClN6O — CID 164533760
5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-2-amine (PubChem CID 164533760) has the molecular formula C24H27ClN6O and a molecular weight of 450.97 g/mol. Its IUPAC name is 5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 164533760 |
| Molecular Formula | C24H27ClN6O |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(N4OCC[C@H]4c4ccccc4)n3)cc2)CC1 |
| InChI | InChI=1S/C24H27ClN6O/c1-29-12-14-30(15-13-29)20-9-7-19(8-10-20)27-24-26-17-21(25)23(28-24)31-22(11-16-32-31)18-5-3-2-4-6-18/h2-10,17,22H,11-16H2,1H3,(H,26,27,28)/t22-/m0/s1 |
| InChIKey | AQCHUYRTWKUZNQ-QFIPXVFZSA-N |
| XLogP | 4.51 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|