C28H32N8O — CID 175754235
N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(1-methylpyrazol-4-yl)-4-(3-phenyl-1,2-oxazolidin-2-yl)pyrimidin-2-amine (PubChem CID 175754235) has the molecular formula C28H32N8O and a molecular weight of 496.62 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(1-methylpyrazol-4-yl)-4-(3-phenyl-1,2-oxazolidin-2-yl)pyrimidin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(1-methylpyrazol-4-yl)-4-(3-phenyl-1,2-oxazolidin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 175754235 |
| Molecular Formula | C28H32N8O |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(1-methylpyrazol-4-yl)-4-(3-phenyl-1,2-oxazolidin-2-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(-c4cnn(C)c4)c(N4OCCC4c4ccccc4)n3)cc2)CC1 |
| InChI | InChI=1S/C28H32N8O/c1-33-13-15-35(16-14-33)24-10-8-23(9-11-24)31-28-29-19-25(22-18-30-34(2)20-22)27(32-28)36-26(12-17-37-36)21-6-4-3-5-7-21/h3-11,18-20,26H,12-17H2,1-2H3,(H,29,31,32) |
| InChIKey | JJTGHJCJRLHBDE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|