C29H31N7O — CID 164533844
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]-5-pyridin-3-ylpyrimidin-2-amine (PubChem CID 164533844) has the molecular formula C29H31N7O and a molecular weight of 493.62 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]-5-pyridin-3-ylpyrimidin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]-5-pyridin-3-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 164533844 |
| Molecular Formula | C29H31N7O |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]-5-pyridin-3-ylpyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(-c4cccnc4)c(N4OCC[C@H]4c4ccccc4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H31N7O/c1-34-15-17-35(18-16-34)25-11-9-24(10-12-25)32-29-31-21-26(23-8-5-14-30-20-23)28(33-29)36-27(13-19-37-36)22-6-3-2-4-7-22/h2-12,14,20-21,27H,13,15-19H2,1H3,(H,31,32,33)/t27-/m0/s1 |
| InChIKey | JGFPCOIQOGNAAF-MHZLTWQESA-N |
| XLogP | 4.92 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|