C26H26N6O2 — CID 46701232
2-[4-(4-methylpiperazin-1-yl)anilino]-8-phenacylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 46701232) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)anilino]-8-phenacylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-8-phenacylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 46701232 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-8-phenacylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(=O)n(CC(=O)c5ccccc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C26H26N6O2/c1-30-13-15-31(16-14-30)22-10-8-21(9-11-22)28-26-27-17-20-7-12-24(34)32(25(20)29-26)18-23(33)19-5-3-2-4-6-19/h2-12,17H,13-16,18H2,1H3,(H,27,28,29) |
| InChIKey | QTAMWBHNXJZQHD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|