C30H34N6O3S — CID 67997535
8-[(2-cyclopentylsulfonylphenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 67997535) has the molecular formula C30H34N6O3S and a molecular weight of 558.71 g/mol. Its IUPAC name is 8-[(2-cyclopentylsulfonylphenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(2-cyclopentylsulfonylphenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 67997535 |
| Molecular Formula | C30H34N6O3S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 8-[(2-cyclopentylsulfonylphenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(=O)n(Cc5ccccc5S(=O)(=O)C5CCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C30H34N6O3S/c1-34-16-18-35(19-17-34)25-13-11-24(12-14-25)32-30-31-20-22-10-15-28(37)36(29(22)33-30)21-23-6-2-5-9-27(23)40(38,39)26-7-3-4-8-26/h2,5-6,9-15,20,26H,3-4,7-8,16-19,21H2,1H3,(H,31,32,33) |
| InChIKey | DESQBPUOCYXXGN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|