C26H32N6O — CID 71724523
8-(cyclohexen-1-yl)-6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 71724523) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is 8-(cyclohexen-1-yl)-6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 8-(cyclohexen-1-yl)-6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 71724523 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 8-(cyclohexen-1-yl)-6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCn1cc(C2=CCCCC2)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C26H32N6O/c1-3-31-18-23(19-7-5-4-6-8-19)24-22(25(31)33)17-27-26(29-24)28-20-9-11-21(12-10-20)32-15-13-30(2)14-16-32/h7,9-12,17-18H,3-6,8,13-16H2,1-2H3,(H,27,28,29) |
| InChIKey | LTRBTLMMISJIHT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|