C27H34N6O4S — CID 149390927
4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylic acid (PubChem CID 149390927) has the molecular formula C27H34N6O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is 4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 149390927 |
| Molecular Formula | C27H34N6O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylic acid |
| SMILES | CN1CCN(c2ccc(Nc3ncc(C(=O)O)c(Cc4cccc(S(=O)(=O)NC(C)(C)C)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H34N6O4S/c1-27(2,3)31-38(36,37)22-7-5-6-19(16-22)17-24-23(25(34)35)18-28-26(30-24)29-20-8-10-21(11-9-20)33-14-12-32(4)13-15-33/h5-11,16,18,31H,12-15,17H2,1-4H3,(H,34,35)(H,28,29,30) |
| InChIKey | YNMZTYRZSUIIIN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|