C28H37N7O4S — CID 129046598
ethyl 4-[3-(tert-butylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate (PubChem CID 129046598) has the molecular formula C28H37N7O4S and a molecular weight of 567.72 g/mol. Its IUPAC name is ethyl 4-[3-(tert-butylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[3-(tert-butylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 129046598 |
| Molecular Formula | C28H37N7O4S |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | ethyl 4-[3-(tert-butylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cccc(NS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H37N7O4S/c1-6-39-26(36)24-19-29-27(31-20-10-12-23(13-11-20)35-16-14-34(5)15-17-35)32-25(24)30-21-8-7-9-22(18-21)33-40(37,38)28(2,3)4/h7-13,18-19,33H,6,14-17H2,1-5H3,(H2,29,30,31,32) |
| InChIKey | OBNRZCQNCMIKIF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|