C24H28ClN7O3 — CID 89388375
ethyl 4-[1-(2-chloroethyl)pyrazole-4-carbonyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate (PubChem CID 89388375) has the molecular formula C24H28ClN7O3 and a molecular weight of 497.99 g/mol. Its IUPAC name is ethyl 4-[1-(2-chloroethyl)pyrazole-4-carbonyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[1-(2-chloroethyl)pyrazole-4-carbonyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 89388375 |
| Molecular Formula | C24H28ClN7O3 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | ethyl 4-[1-(2-chloroethyl)pyrazole-4-carbonyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1C(=O)c1cnn(CCCl)c1 |
| InChI | InChI=1S/C24H28ClN7O3/c1-3-35-23(34)20-15-26-24(29-21(20)22(33)17-14-27-32(16-17)9-8-25)28-18-4-6-19(7-5-18)31-12-10-30(2)11-13-31/h4-7,14-16H,3,8-13H2,1-2H3,(H,26,28,29) |
| InChIKey | ZPYPQULSNQLVCL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|