C30H36N6O3 — CID 71224013
ethyl 4-[3-[(cyclobutylamino)methyl]benzoyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate (PubChem CID 71224013) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is ethyl 4-[3-[(cyclobutylamino)methyl]benzoyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[3-[(cyclobutylamino)methyl]benzoyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71224013 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | ethyl 4-[3-[(cyclobutylamino)methyl]benzoyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1C(=O)c1cccc(CNC2CCC2)c1 |
| InChI | InChI=1S/C30H36N6O3/c1-3-39-29(38)26-20-32-30(33-24-10-12-25(13-11-24)36-16-14-35(2)15-17-36)34-27(26)28(37)22-7-4-6-21(18-22)19-31-23-8-5-9-23/h4,6-7,10-13,18,20,23,31H,3,5,8-9,14-17,19H2,1-2H3,(H,32,33,34) |
| InChIKey | AQOPOVQIXJOXLN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|