C34H28Cl4N10O — CID 71224488
6-(2,6-dichlorophenyl)-8-[6-[2-(2,6-dichlorophenyl)hydrazinyl]-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one (PubChem CID 71224488) has the molecular formula C34H28Cl4N10O and a molecular weight of 734.48 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-[6-[2-(2,6-dichlorophenyl)hydrazinyl]-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-[6-[2-(2,6-dichlorophenyl)hydrazinyl]-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 71224488 |
| Molecular Formula | C34H28Cl4N10O |
| Molecular Weight | 734.48 g/mol |
| Exact Mass | 732.12 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-[6-[2-(2,6-dichlorophenyl)hydrazinyl]-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n(-c5c(Cl)cccc5Cl)nc(-c5cccc(NNc6c(Cl)cccc6Cl)n5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C34H28Cl4N10O/c1-46-15-17-47(18-16-46)21-13-11-20(12-14-21)40-34-39-19-22-29(42-34)31(45-48(33(22)49)32-25(37)7-3-8-26(32)38)27-9-4-10-28(41-27)43-44-30-23(35)5-2-6-24(30)36/h2-14,19,44H,15-18H2,1H3,(H,41,43)(H,39,40,42) |
| InChIKey | NQVOJLBCGSKOMF-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.48 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|