C23H22N6O4S2 — CID 89388381
2-(4-morpholin-4-ylsulfonylanilino)-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one (PubChem CID 89388381) has the molecular formula C23H22N6O4S2 and a molecular weight of 510.60 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonylanilino)-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 2-(4-morpholin-4-ylsulfonylanilino)-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 89388381 |
| Molecular Formula | C23H22N6O4S2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonylanilino)-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one |
| SMILES | C=CCn1nc(-c2cccs2)c2nc(Nc3ccc(S(=O)(=O)N4CCOCC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C23H22N6O4S2/c1-2-9-29-22(30)18-15-24-23(26-20(18)21(27-29)19-4-3-14-34-19)25-16-5-7-17(8-6-16)35(31,32)28-10-12-33-13-11-28/h2-8,14-15H,1,9-13H2,(H,24,25,26) |
| InChIKey | HBILXUVCJJYHAN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|