C23H20N6O2S — CID 89388325
2-[4-(2-oxopyrrolidin-1-yl)anilino]-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one (PubChem CID 89388325) has the molecular formula C23H20N6O2S and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-[4-(2-oxopyrrolidin-1-yl)anilino]-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 2-[4-(2-oxopyrrolidin-1-yl)anilino]-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 89388325 |
| Molecular Formula | C23H20N6O2S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-[4-(2-oxopyrrolidin-1-yl)anilino]-6-prop-2-enyl-8-thiophen-2-ylpyrimido[4,5-d]pyridazin-5-one |
| SMILES | C=CCn1nc(-c2cccs2)c2nc(Nc3ccc(N4CCCC4=O)cc3)ncc2c1=O |
| InChI | InChI=1S/C23H20N6O2S/c1-2-11-29-22(31)17-14-24-23(26-20(17)21(27-29)18-5-4-13-32-18)25-15-7-9-16(10-8-15)28-12-3-6-19(28)30/h2,4-5,7-10,13-14H,1,3,6,11-12H2,(H,24,25,26) |
| InChIKey | MBXICTKLUAUBDJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|