C25H24N6OS — CID 171547324
5-ethynyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 171547324) has the molecular formula C25H24N6OS and a molecular weight of 456.58 g/mol. Its IUPAC name is 5-ethynyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 5-ethynyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171547324 |
| Molecular Formula | C25H24N6OS |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 5-ethynyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C#Cc1c(-c2cccs2)c(=O)n(C)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc12 |
| InChI | InChI=1S/C25H24N6OS/c1-4-19-20-16-26-25(28-23(20)30(3)24(32)22(19)21-6-5-15-33-21)27-17-7-9-18(10-8-17)31-13-11-29(2)12-14-31/h1,5-10,15-16H,11-14H2,2-3H3,(H,26,27,28) |
| InChIKey | FWPUCBXTOBVASM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|