C27H29N7O — CID 171546808
6-anilino-2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-5-ethynyl-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546808) has the molecular formula C27H29N7O and a molecular weight of 467.58 g/mol. Its IUPAC name is 6-anilino-2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-5-ethynyl-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-anilino-2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-5-ethynyl-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546808 |
| Molecular Formula | C27H29N7O |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 6-anilino-2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-5-ethynyl-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C#Cc1c(Nc2ccccc2)c(=O)n(C)c2nc(Nc3ccc(N(C)CCN(C)C)cc3)ncc12 |
| InChI | InChI=1S/C27H29N7O/c1-6-22-23-18-28-27(30-20-12-14-21(15-13-20)33(4)17-16-32(2)3)31-25(23)34(5)26(35)24(22)29-19-10-8-7-9-11-19/h1,7-15,18,29H,16-17H2,2-5H3,(H,28,30,31) |
| InChIKey | XJWZEIZQYAQOKO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|