C27H30N6O — CID 175172009
2-[2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]pyrimidin-5-yl]-2-naphthalen-1-ylacetamide (PubChem CID 175172009) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-[2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]pyrimidin-5-yl]-2-naphthalen-1-ylacetamide.
| Compound Name | 2-[2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]pyrimidin-5-yl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 175172009 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]pyrimidin-5-yl]-2-naphthalen-1-ylacetamide |
| SMILES | CN(C)CCN(C)c1ccc(Nc2ncc(C(C(N)=O)c3cccc4ccccc34)cn2)cc1 |
| InChI | InChI=1S/C27H30N6O/c1-32(2)15-16-33(3)22-13-11-21(12-14-22)31-27-29-17-20(18-30-27)25(26(28)34)24-10-6-8-19-7-4-5-9-23(19)24/h4-14,17-18,25H,15-16H2,1-3H3,(H2,28,34)(H,29,30,31) |
| InChIKey | KZXCFJNBZCSGLO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|