C35H46N6OSi — CID 171547367
2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171547367) has the molecular formula C35H46N6OSi and a molecular weight of 594.88 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171547367 |
| Molecular Formula | C35H46N6OSi |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | 2-[4-[2-(dimethylamino)ethyl-methylamino]anilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(C)[Si](C#Cc1cc(=O)n(-c2ccccc2)c2nc(Nc3ccc(N(C)CCN(C)C)cc3)ncc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H46N6OSi/c1-25(2)43(26(3)4,27(5)6)22-19-28-23-33(42)41(31-13-11-10-12-14-31)34-32(28)24-36-35(38-34)37-29-15-17-30(18-16-29)40(9)21-20-39(7)8/h10-18,23-27H,20-21H2,1-9H3,(H,36,37,38) |
| InChIKey | FOVFWROJRHTYMV-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|