C36H48N6OSi — CID 171546709
2-[4-[2-(dimethylamino)ethyl-methylamino]-3-methylanilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546709) has the molecular formula C36H48N6OSi and a molecular weight of 608.91 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)ethyl-methylamino]-3-methylanilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-[2-(dimethylamino)ethyl-methylamino]-3-methylanilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546709 |
| Molecular Formula | C36H48N6OSi |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.37 |
| IUPAC Name | 2-[4-[2-(dimethylamino)ethyl-methylamino]-3-methylanilino]-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(Nc2ncc3c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(=O)n(-c4ccccc4)c3n2)ccc1N(C)CCN(C)C |
| InChI | InChI=1S/C36H48N6OSi/c1-25(2)44(26(3)4,27(5)6)21-18-29-23-34(43)42(31-14-12-11-13-15-31)35-32(29)24-37-36(39-35)38-30-16-17-33(28(7)22-30)41(10)20-19-40(8)9/h11-17,22-27H,19-20H2,1-10H3,(H,37,38,39) |
| InChIKey | YCRJCLGXFJSXHE-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|