C32H36N4O4Si — CID 171547483
2-(2-methoxyanilino)-7-oxo-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 171547483) has the molecular formula C32H36N4O4Si and a molecular weight of 568.75 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-7-oxo-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 2-(2-methoxyanilino)-7-oxo-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 171547483 |
| Molecular Formula | C32H36N4O4Si |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 2-(2-methoxyanilino)-7-oxo-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | COc1ccccc1Nc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(C(=O)O)c(=O)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C32H36N4O4Si/c1-20(2)41(21(3)4,22(5)6)18-17-24-25-19-33-32(34-26-15-11-12-16-27(26)40-7)35-29(25)36(23-13-9-8-10-14-23)30(37)28(24)31(38)39/h8-16,19-22H,1-7H3,(H,38,39)(H,33,34,35) |
| InChIKey | SFQHNYZEMJOYMF-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|