C26H33N3O3SSi — CID 171546978
6-methyl-2-methylsulfonyl-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546978) has the molecular formula C26H33N3O3SSi and a molecular weight of 495.72 g/mol. Its IUPAC name is 6-methyl-2-methylsulfonyl-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-methyl-2-methylsulfonyl-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546978 |
| Molecular Formula | C26H33N3O3SSi |
| Molecular Weight | 495.72 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 6-methyl-2-methylsulfonyl-8-phenyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cnc(S(C)(=O)=O)nc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C26H33N3O3SSi/c1-17(2)34(18(3)4,19(5)6)15-14-22-20(7)25(30)29(21-12-10-9-11-13-21)24-23(22)16-27-26(28-24)33(8,31)32/h9-13,16-19H,1-8H3 |
| InChIKey | VHVHLGAAKSWTTL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|