C26H34N4OSSi — CID 171546923
6-methyl-2-methylsulfanyl-8-(pyridin-2-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546923) has the molecular formula C26H34N4OSSi and a molecular weight of 478.74 g/mol. Its IUPAC name is 6-methyl-2-methylsulfanyl-8-(pyridin-2-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-methyl-2-methylsulfanyl-8-(pyridin-2-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546923 |
| Molecular Formula | C26H34N4OSSi |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 6-methyl-2-methylsulfanyl-8-(pyridin-2-ylmethyl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(C)c(=O)n(Cc3ccccn3)c2n1 |
| InChI | InChI=1S/C26H34N4OSSi/c1-17(2)33(18(3)4,19(5)6)14-12-22-20(7)25(31)30(16-21-11-9-10-13-27-21)24-23(22)15-28-26(29-24)32-8/h9-11,13,15,17-19H,16H2,1-8H3 |
| InChIKey | QUQXRQWPXPUXBR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|