C22H33N3OSSi — CID 171546993
2-methylsulfanyl-8-propan-2-yl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546993) has the molecular formula C22H33N3OSSi and a molecular weight of 415.68 g/mol. Its IUPAC name is 2-methylsulfanyl-8-propan-2-yl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-methylsulfanyl-8-propan-2-yl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546993 |
| Molecular Formula | C22H33N3OSSi |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-methylsulfanyl-8-propan-2-yl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(=O)n(C(C)C)c2n1 |
| InChI | InChI=1S/C22H33N3OSSi/c1-14(2)25-20(26)12-18(19-13-23-22(27-9)24-21(19)25)10-11-28(15(3)4,16(5)6)17(7)8/h12-17H,1-9H3 |
| InChIKey | PUCIADQHROOCMK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|