C26H41N5SSi — CID 171546220
1-cyclopentyl-N-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]ethane-1,2-diamine (PubChem CID 171546220) has the molecular formula C26H41N5SSi and a molecular weight of 483.80 g/mol. Its IUPAC name is 1-cyclopentyl-N-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]ethane-1,2-diamine.
| Compound Name | 1-cyclopentyl-N-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 171546220 |
| Molecular Formula | C26H41N5SSi |
| Molecular Weight | 483.80 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 1-cyclopentyl-N-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]ethane-1,2-diamine |
| SMILES | CSc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(NC(CN)C3CCCC3)nc2n1 |
| InChI | InChI=1S/C26H41N5SSi/c1-17(2)33(18(3)4,19(5)6)13-12-21-14-24(29-23(15-27)20-10-8-9-11-20)30-25-22(21)16-28-26(31-25)32-7/h14,16-20,23H,8-11,15,27H2,1-7H3,(H,28,29,30,31) |
| InChIKey | UOHKULLAHYXCJL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.80 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|