C34H47N5O2SSi — CID 171546497
benzyl N-[2-cyclopentyl-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]ethyl]carbamate (PubChem CID 171546497) has the molecular formula C34H47N5O2SSi and a molecular weight of 617.94 g/mol. Its IUPAC name is benzyl N-[2-cyclopentyl-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-cyclopentyl-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 171546497 |
| Molecular Formula | C34H47N5O2SSi |
| Molecular Weight | 617.94 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | benzyl N-[2-cyclopentyl-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]ethyl]carbamate |
| SMILES | CSc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(NC(CNC(=O)OCc3ccccc3)C3CCCC3)nc2n1 |
| InChI | InChI=1S/C34H47N5O2SSi/c1-23(2)43(24(3)4,25(5)6)18-17-28-19-31(38-32-29(28)20-35-33(39-32)42-7)37-30(27-15-11-12-16-27)21-36-34(40)41-22-26-13-9-8-10-14-26/h8-10,13-14,19-20,23-25,27,30H,11-12,15-16,21-22H2,1-7H3,(H,36,40)(H,35,37,38,39) |
| InChIKey | IPDHTMKBRDREIG-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.94 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|