C21H32N2O2 — CID 59362143
benzyl N-[[(2S)-1-(1-cyclohexylethyl)pyrrolidin-2-yl]methyl]carbamate (PubChem CID 59362143) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is benzyl N-[[(2S)-1-(1-cyclohexylethyl)pyrrolidin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(2S)-1-(1-cyclohexylethyl)pyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 59362143 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | benzyl N-[[(2S)-1-(1-cyclohexylethyl)pyrrolidin-2-yl]methyl]carbamate |
| SMILES | CC(C1CCCCC1)N1CCC[C@H]1CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O2/c1-17(19-11-6-3-7-12-19)23-14-8-13-20(23)15-22-21(24)25-16-18-9-4-2-5-10-18/h2,4-5,9-10,17,19-20H,3,6-8,11-16H2,1H3,(H,22,24)/t17?,20-/m0/s1 |
| InChIKey | MGCHWVFXFQHFDL-OZBJMMHXSA-N |
| XLogP | 4.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |