C20H28N2O6 — CID 72533168
diethyl 2-[2-(phenylmethoxycarbonylaminomethyl)pyrrolidin-1-yl]propanedioate (PubChem CID 72533168) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is diethyl 2-[2-(phenylmethoxycarbonylaminomethyl)pyrrolidin-1-yl]propanedioate.
| Compound Name | diethyl 2-[2-(phenylmethoxycarbonylaminomethyl)pyrrolidin-1-yl]propanedioate |
|---|---|
| PubChem CID | 72533168 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | diethyl 2-[2-(phenylmethoxycarbonylaminomethyl)pyrrolidin-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)N1CCCC1CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H28N2O6/c1-3-26-18(23)17(19(24)27-4-2)22-12-8-11-16(22)13-21-20(25)28-14-15-9-6-5-7-10-15/h5-7,9-10,16-17H,3-4,8,11-14H2,1-2H3,(H,21,25) |
| InChIKey | XAUBVKTVEYQFBI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|