C21H29NO6 — CID 58375775
diethyl 2-[(2R)-2-(3-oxo-3-phenylmethoxypropyl)pyrrolidin-1-yl]propanedioate (PubChem CID 58375775) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is diethyl 2-[(2R)-2-(3-oxo-3-phenylmethoxypropyl)pyrrolidin-1-yl]propanedioate.
| Compound Name | diethyl 2-[(2R)-2-(3-oxo-3-phenylmethoxypropyl)pyrrolidin-1-yl]propanedioate |
|---|---|
| PubChem CID | 58375775 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | diethyl 2-[(2R)-2-(3-oxo-3-phenylmethoxypropyl)pyrrolidin-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)N1CCC[C@@H]1CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO6/c1-3-26-20(24)19(21(25)27-4-2)22-14-8-11-17(22)12-13-18(23)28-15-16-9-6-5-7-10-16/h5-7,9-10,17,19H,3-4,8,11-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | TVSFBNHVVMNDPB-QGZVFWFLSA-N |
| XLogP | 2.47 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|