C16H25N3O2 — CID 96553890
benzyl N-[[(2R)-1-(2-aminoethyl)piperidin-2-yl]methyl]carbamate (PubChem CID 96553890) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is benzyl N-[[(2R)-1-(2-aminoethyl)piperidin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(2R)-1-(2-aminoethyl)piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 96553890 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | benzyl N-[[(2R)-1-(2-aminoethyl)piperidin-2-yl]methyl]carbamate |
| SMILES | NCCN1CCCC[C@@H]1CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H25N3O2/c17-9-11-19-10-5-4-8-15(19)12-18-16(20)21-13-14-6-2-1-3-7-14/h1-3,6-7,15H,4-5,8-13,17H2,(H,18,20)/t15-/m1/s1 |
| InChIKey | RBYHRCVNXAGCJY-OAHLLOKOSA-N |
| XLogP | 1.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |