C20H27N3O2 — CID 178159822
benzyl N-[[(1S)-3-methylcyclohexyl]-(2-methyl-1H-imidazol-5-yl)methyl]carbamate (PubChem CID 178159822) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is benzyl N-[[(1S)-3-methylcyclohexyl]-(2-methyl-1H-imidazol-5-yl)methyl]carbamate.
| Compound Name | benzyl N-[[(1S)-3-methylcyclohexyl]-(2-methyl-1H-imidazol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 178159822 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | benzyl N-[[(1S)-3-methylcyclohexyl]-(2-methyl-1H-imidazol-5-yl)methyl]carbamate |
| SMILES | Cc1ncc(C(NC(=O)OCc2ccccc2)[C@H]2CCCC(C)C2)[nH]1 |
| InChI | InChI=1S/C20H27N3O2/c1-14-7-6-10-17(11-14)19(18-12-21-15(2)22-18)23-20(24)25-13-16-8-4-3-5-9-16/h3-5,8-9,12,14,17,19H,6-7,10-11,13H2,1-2H3,(H,21,22)(H,23,24)/t14?,17-,19?/m0/s1 |
| InChIKey | LAJXJVSTVOHMIK-KGYZHSKHSA-N |
| XLogP | 4.51 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |