C28H45N5O3SSi — CID 171546245
tert-butyl N-[(2S)-3-methoxy-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]propyl]carbamate (PubChem CID 171546245) has the molecular formula C28H45N5O3SSi and a molecular weight of 559.85 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methoxy-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methoxy-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 171546245 |
| Molecular Formula | C28H45N5O3SSi |
| Molecular Weight | 559.85 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | tert-butyl N-[(2S)-3-methoxy-2-[[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]amino]propyl]carbamate |
| SMILES | COC[C@H](CNC(=O)OC(C)(C)C)Nc1cc(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cnc(SC)nc2n1 |
| InChI | InChI=1S/C28H45N5O3SSi/c1-18(2)38(19(3)4,20(5)6)13-12-21-14-24(32-25-23(21)16-29-26(33-25)37-11)31-22(17-35-10)15-30-27(34)36-28(7,8)9/h14,16,18-20,22H,15,17H2,1-11H3,(H,30,34)(H,29,31,32,33)/t22-/m0/s1 |
| InChIKey | PMIYTWNWJSKRAZ-QFIPXVFZSA-N |
| XLogP | 6.27 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.85 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|