C25H31N3OSSi — CID 171546629
2-(2-methylsulfanyl-7-phenoxypyrido[2,3-d]pyrimidin-5-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 171546629) has the molecular formula C25H31N3OSSi and a molecular weight of 449.70 g/mol. Its IUPAC name is 2-(2-methylsulfanyl-7-phenoxypyrido[2,3-d]pyrimidin-5-yl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(2-methylsulfanyl-7-phenoxypyrido[2,3-d]pyrimidin-5-yl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 171546629 |
| Molecular Formula | C25H31N3OSSi |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-(2-methylsulfanyl-7-phenoxypyrido[2,3-d]pyrimidin-5-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | CSc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(Oc3ccccc3)nc2n1 |
| InChI | InChI=1S/C25H31N3OSSi/c1-17(2)31(18(3)4,19(5)6)14-13-20-15-23(29-21-11-9-8-10-12-21)27-24-22(20)16-26-25(28-24)30-7/h8-12,15-19H,1-7H3 |
| InChIKey | GADHYZXCILAWIF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|