C24H35N3O4SSi — CID 171546741
2-methylsulfonyl-8-(oxan-4-yl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171546741) has the molecular formula C24H35N3O4SSi and a molecular weight of 489.71 g/mol. Its IUPAC name is 2-methylsulfonyl-8-(oxan-4-yl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-methylsulfonyl-8-(oxan-4-yl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171546741 |
| Molecular Formula | C24H35N3O4SSi |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-methylsulfonyl-8-(oxan-4-yl)-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(C)[Si](C#Cc1cc(=O)n(C2CCOCC2)c2nc(S(C)(=O)=O)ncc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H35N3O4SSi/c1-16(2)33(17(3)4,18(5)6)13-10-19-14-22(28)27(20-8-11-31-12-9-20)23-21(19)15-25-24(26-23)32(7,29)30/h14-18,20H,8-9,11-12H2,1-7H3 |
| InChIKey | LDIOYONPVJCLMR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|