C14H17N3O3S — CID 146673939
8-cyclohexyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 146673939) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 8-cyclohexyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclohexyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 146673939 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 8-cyclohexyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CS(=O)(=O)c1ncc2ccc(=O)n(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C14H17N3O3S/c1-21(19,20)14-15-9-10-7-8-12(18)17(13(10)16-14)11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3 |
| InChIKey | DLCYBGIJRWKWHB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |