C13H15N3O2S — CID 10826395
8-cyclopentyl-2-methylsulfinylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 10826395) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 8-cyclopentyl-2-methylsulfinylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-methylsulfinylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10826395 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 8-cyclopentyl-2-methylsulfinylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CS(=O)c1ncc2ccc(=O)n(C3CCCC3)c2n1 |
| InChI | InChI=1S/C13H15N3O2S/c1-19(18)13-14-8-9-6-7-11(17)16(12(9)15-13)10-4-2-3-5-10/h6-8,10H,2-5H2,1H3 |
| InChIKey | UDTZHILTPAKHBR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |