C14H15N3O3S — CID 169257579
8-[(1R)-2-methylidenecyclopentyl]-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 169257579) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 8-[(1R)-2-methylidenecyclopentyl]-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(1R)-2-methylidenecyclopentyl]-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169257579 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 8-[(1R)-2-methylidenecyclopentyl]-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=C1CCC[C@H]1n1c(=O)ccc2cnc(S(C)(=O)=O)nc21 |
| InChI | InChI=1S/C14H15N3O3S/c1-9-4-3-5-11(9)17-12(18)7-6-10-8-15-14(16-13(10)17)21(2,19)20/h6-8,11H,1,3-5H2,2H3/t11-/m1/s1 |
| InChIKey | CTZRHBVKCPLLJV-LLVKDONJSA-N |
| XLogP | 1.48 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|