About 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one
2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 156734462) has the molecular formula C11H15N3O3S
and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 156734462 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(C)n1c(=O)ccc2cnc(S(C)(O)O)nc21 |
| InChI | InChI=1S/C11H15N3O3S/c1-7(2)14-9(15)5-4-8-6-12-11(13-10(8)14)18(3,16)17/h4-7,16-17H,1-3H3 |
| InChIKey | SXBALGCZVCIDFI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one (CID 156734462) is 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one is CC(C)n1c(=O)ccc2cnc(S(C)(O)O)nc21.
What is the InChIKey of 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is SXBALGCZVCIDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S/c1-7(2)14-9(15)5-4-8-6-12-11(13-10(8)14)18(3,16)17/h4-7,16-17H,1-3H3.
What are the key properties of 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one?
2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 269.33 g/mol, XLogP of 2.11, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[dihydroxy(methyl)-λ4-sulfanyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 156734462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).