C13H16N2O3 — CID 137470063
7-(2-hydroxyethoxy)-1-propan-2-yl-1,8-naphthyridin-2-one (PubChem CID 137470063) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 7-(2-hydroxyethoxy)-1-propan-2-yl-1,8-naphthyridin-2-one.
| Compound Name | 7-(2-hydroxyethoxy)-1-propan-2-yl-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 137470063 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 7-(2-hydroxyethoxy)-1-propan-2-yl-1,8-naphthyridin-2-one |
| SMILES | CC(C)n1c(=O)ccc2ccc(OCCO)nc21 |
| InChI | InChI=1S/C13H16N2O3/c1-9(2)15-12(17)6-4-10-3-5-11(14-13(10)15)18-8-7-16/h3-6,9,16H,7-8H2,1-2H3 |
| InChIKey | LFCHTJITCHDCRU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |